About 4-[3-(4-aminophenoxy)phenoxy]aniline;toluene;hydrochloride
4-[3-(4-aminophenoxy)phenoxy]aniline;toluene;hydrochloride (PubChem CID 70184053) has the molecular formula C25H25ClN2O2
and a molecular weight of 420.94 g/mol. Its IUPAC name is 4-[3-(4-aminophenoxy)phenoxy]aniline;toluene;hydrochloride.
Molecular Properties
| Compound Name | 4-[3-(4-aminophenoxy)phenoxy]aniline;toluene;hydrochloride |
| PubChem CID | 70184053 |
| Molecular Formula | C25H25ClN2O2 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 4-[3-(4-aminophenoxy)phenoxy]aniline;toluene;hydrochloride |
| SMILES | Cc1ccccc1.Cl.Nc1ccc(Oc2cccc(Oc3ccc(N)cc3)c2)cc1 |
| InChI | InChI=1S/C18H16N2O2.C7H8.ClH/c19-13-4-8-15(9-5-13)21-17-2-1-3-18(12-17)22-16-10-6-14(20)7-11-16;1-7-5-3-2-4-6-7;/h1-12H,19-20H2;2-6H,1H3;1H |
| InChIKey | BBLGUFQQXPWYFV-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(4-aminophenoxy)phenoxy]aniline;toluene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(4-aminophenoxy)phenoxy]aniline;toluene;hydrochloride?
The IUPAC name of 4-[3-(4-aminophenoxy)phenoxy]aniline;toluene;hydrochloride (CID 70184053) is 4-[3-(4-aminophenoxy)phenoxy]aniline;toluene;hydrochloride.
What is the SMILES notation for 4-[3-(4-aminophenoxy)phenoxy]aniline;toluene;hydrochloride?
The canonical SMILES for 4-[3-(4-aminophenoxy)phenoxy]aniline;toluene;hydrochloride is Cc1ccccc1.Cl.Nc1ccc(Oc2cccc(Oc3ccc(N)cc3)c2)cc1.
What is the InChIKey of 4-[3-(4-aminophenoxy)phenoxy]aniline;toluene;hydrochloride?
The InChIKey is BBLGUFQQXPWYFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O2.C7H8.ClH/c19-13-4-8-15(9-5-13)21-17-2-1-3-18(12-17)22-16-10-6-14(20)7-11-16;1-7-5-3-2-4-6-7;/h1-12H,19-20H2;2-6H,1H3;1H.
What are the key properties of 4-[3-(4-aminophenoxy)phenoxy]aniline;toluene;hydrochloride?
4-[3-(4-aminophenoxy)phenoxy]aniline;toluene;hydrochloride has a molecular weight of 420.94 g/mol, XLogP of 6.85, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(4-aminophenoxy)phenoxy]aniline;toluene;hydrochloride is sourced from PubChem (CID 70184053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).