About 3-methylaniline;1-methyl-3-phenoxybenzene
3-methylaniline;1-methyl-3-phenoxybenzene (PubChem CID 144834027) has the molecular formula C20H21NO
and a molecular weight of 291.39 g/mol. Its IUPAC name is 3-methylaniline;1-methyl-3-phenoxybenzene.
Molecular Properties
| Compound Name | 3-methylaniline;1-methyl-3-phenoxybenzene |
| PubChem CID | 144834027 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 3-methylaniline;1-methyl-3-phenoxybenzene |
| SMILES | Cc1cccc(N)c1.Cc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C13H12O.C7H9N/c1-11-6-5-9-13(10-11)14-12-7-3-2-4-8-12;1-6-3-2-4-7(8)5-6/h2-10H,1H3;2-5H,8H2,1H3 |
| InChIKey | YYXITOLWGBNGPQ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-methylaniline;1-methyl-3-phenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylaniline;1-methyl-3-phenoxybenzene?
The IUPAC name of 3-methylaniline;1-methyl-3-phenoxybenzene (CID 144834027) is 3-methylaniline;1-methyl-3-phenoxybenzene.
What is the SMILES notation for 3-methylaniline;1-methyl-3-phenoxybenzene?
The canonical SMILES for 3-methylaniline;1-methyl-3-phenoxybenzene is Cc1cccc(N)c1.Cc1cccc(Oc2ccccc2)c1.
What is the InChIKey of 3-methylaniline;1-methyl-3-phenoxybenzene?
The InChIKey is YYXITOLWGBNGPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O.C7H9N/c1-11-6-5-9-13(10-11)14-12-7-3-2-4-8-12;1-6-3-2-4-7(8)5-6/h2-10H,1H3;2-5H,8H2,1H3.
What are the key properties of 3-methylaniline;1-methyl-3-phenoxybenzene?
3-methylaniline;1-methyl-3-phenoxybenzene has a molecular weight of 291.39 g/mol, XLogP of 5.36, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylaniline;1-methyl-3-phenoxybenzene is sourced from PubChem (CID 144834027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).