About 3-methylaniline
3-methylaniline (PubChem CID 7934) has the molecular formula C7H9N
and a molecular weight of 107.16 g/mol. Its IUPAC name is 3-methylaniline.
Molecular Properties
| Compound Name | 3-methylaniline |
| PubChem CID | 7934 |
| Molecular Formula | C7H9N |
| Molecular Weight | 107.16 g/mol |
| Exact Mass | 107.07 |
| IUPAC Name | 3-methylaniline |
| SMILES | Cc1cccc(N)c1 |
| InChI | InChI=1S/C7H9N/c1-6-3-2-4-7(8)5-6/h2-5H,8H2,1H3 |
| InChIKey | JJYPMNFTHPTTDI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.16 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylaniline?
The IUPAC name of 3-methylaniline (CID 7934) is 3-methylaniline.
What is the SMILES notation for 3-methylaniline?
The canonical SMILES for 3-methylaniline is Cc1cccc(N)c1.
What is the InChIKey of 3-methylaniline?
The InChIKey is JJYPMNFTHPTTDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N/c1-6-3-2-4-7(8)5-6/h2-5H,8H2,1H3.
What are the key properties of 3-methylaniline?
3-methylaniline has a molecular weight of 107.16 g/mol, XLogP of 1.58, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylaniline is sourced from PubChem (CID 7934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).