About acetic acid;ethane;3-methylaniline
acetic acid;ethane;3-methylaniline (PubChem CID 142238928) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is acetic acid;ethane;3-methylaniline.
Molecular Properties
| Compound Name | acetic acid;ethane;3-methylaniline |
| PubChem CID | 142238928 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | acetic acid;ethane;3-methylaniline |
| SMILES | CC.CC(=O)O.Cc1cccc(N)c1 |
| InChI | InChI=1S/C7H9N.C2H4O2.C2H6/c1-6-3-2-4-7(8)5-6;1-2(3)4;1-2/h2-5H,8H2,1H3;1H3,(H,3,4);1-2H3 |
| InChIKey | QFUOCWJHHPOKRC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;ethane;3-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;ethane;3-methylaniline?
The IUPAC name of acetic acid;ethane;3-methylaniline (CID 142238928) is acetic acid;ethane;3-methylaniline.
What is the SMILES notation for acetic acid;ethane;3-methylaniline?
The canonical SMILES for acetic acid;ethane;3-methylaniline is CC.CC(=O)O.Cc1cccc(N)c1.
What is the InChIKey of acetic acid;ethane;3-methylaniline?
The InChIKey is QFUOCWJHHPOKRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C2H4O2.C2H6/c1-6-3-2-4-7(8)5-6;1-2(3)4;1-2/h2-5H,8H2,1H3;1H3,(H,3,4);1-2H3.
What are the key properties of acetic acid;ethane;3-methylaniline?
acetic acid;ethane;3-methylaniline has a molecular weight of 197.28 g/mol, XLogP of 2.69, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;ethane;3-methylaniline is sourced from PubChem (CID 142238928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).