About ethane;ethene;3-methylaniline
ethane;ethene;3-methylaniline (PubChem CID 145478894) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is ethane;ethene;3-methylaniline.
Molecular Properties
| Compound Name | ethane;ethene;3-methylaniline |
| PubChem CID | 145478894 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | ethane;ethene;3-methylaniline |
| SMILES | C=C.CC.Cc1cccc(N)c1 |
| InChI | InChI=1S/C7H9N.C2H6.C2H4/c1-6-3-2-4-7(8)5-6;2*1-2/h2-5H,8H2,1H3;1-2H3;1-2H2 |
| InChIKey | IDNTZXHGOMOFPC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethene;3-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethene;3-methylaniline?
The IUPAC name of ethane;ethene;3-methylaniline (CID 145478894) is ethane;ethene;3-methylaniline.
What is the SMILES notation for ethane;ethene;3-methylaniline?
The canonical SMILES for ethane;ethene;3-methylaniline is C=C.CC.Cc1cccc(N)c1.
What is the InChIKey of ethane;ethene;3-methylaniline?
The InChIKey is IDNTZXHGOMOFPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C2H6.C2H4/c1-6-3-2-4-7(8)5-6;2*1-2/h2-5H,8H2,1H3;1-2H3;1-2H2.
What are the key properties of ethane;ethene;3-methylaniline?
ethane;ethene;3-methylaniline has a molecular weight of 165.28 g/mol, XLogP of 3.41, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethene;3-methylaniline is sourced from PubChem (CID 145478894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).