About ethane;methane;1,3-xylene
ethane;methane;1,3-xylene (PubChem CID 145463381) has the molecular formula C15H34
and a molecular weight of 214.44 g/mol. Its IUPAC name is ethane;methane;1,3-xylene.
Molecular Properties
| Compound Name | ethane;methane;1,3-xylene |
| PubChem CID | 145463381 |
| Molecular Formula | C15H34 |
| Molecular Weight | 214.44 g/mol |
| Exact Mass | 214.27 |
| IUPAC Name | ethane;methane;1,3-xylene |
| SMILES | C.C.C.CC.CC.Cc1cccc(C)c1 |
| InChI | InChI=1S/C8H10.2C2H6.3CH4/c1-7-4-3-5-8(2)6-7;2*1-2;;;/h3-6H,1-2H3;2*1-2H3;3*1H4 |
| InChIKey | AOCBDXJLAGOBTN-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 214.44 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;methane;1,3-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;1,3-xylene?
The IUPAC name of ethane;methane;1,3-xylene (CID 145463381) is ethane;methane;1,3-xylene.
What is the SMILES notation for ethane;methane;1,3-xylene?
The canonical SMILES for ethane;methane;1,3-xylene is C.C.C.CC.CC.Cc1cccc(C)c1.
What is the InChIKey of ethane;methane;1,3-xylene?
The InChIKey is AOCBDXJLAGOBTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.2C2H6.3CH4/c1-7-4-3-5-8(2)6-7;2*1-2;;;/h3-6H,1-2H3;2*1-2H3;3*1H4.
What are the key properties of ethane;methane;1,3-xylene?
ethane;methane;1,3-xylene has a molecular weight of 214.44 g/mol, XLogP of 6.26, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;1,3-xylene is sourced from PubChem (CID 145463381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).