About carbon dioxide;1,3-xylene
carbon dioxide;1,3-xylene (PubChem CID 160806691) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is carbon dioxide;1,3-xylene.
Molecular Properties
| Compound Name | carbon dioxide;1,3-xylene |
| PubChem CID | 160806691 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | carbon dioxide;1,3-xylene |
| SMILES | Cc1cccc(C)c1.O=C=O |
| InChI | InChI=1S/C8H10.CO2/c1-7-4-3-5-8(2)6-7;2-1-3/h3-6H,1-2H3; |
| InChIKey | SDTZHPIUJRXROF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze carbon dioxide;1,3-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;1,3-xylene?
The IUPAC name of carbon dioxide;1,3-xylene (CID 160806691) is carbon dioxide;1,3-xylene.
What is the SMILES notation for carbon dioxide;1,3-xylene?
The canonical SMILES for carbon dioxide;1,3-xylene is Cc1cccc(C)c1.O=C=O.
What is the InChIKey of carbon dioxide;1,3-xylene?
The InChIKey is SDTZHPIUJRXROF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.CO2/c1-7-4-3-5-8(2)6-7;2-1-3/h3-6H,1-2H3;.
What are the key properties of carbon dioxide;1,3-xylene?
carbon dioxide;1,3-xylene has a molecular weight of 150.18 g/mol, XLogP of 1.72, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;1,3-xylene is sourced from PubChem (CID 160806691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).