About bis(acetonitrile);azane;1,3-xylene
bis(acetonitrile);azane;1,3-xylene (PubChem CID 70638628) has the molecular formula C12H22N4
and a molecular weight of 222.34 g/mol. Its IUPAC name is bis(acetonitrile);azane;1,3-xylene.
Molecular Properties
| Compound Name | bis(acetonitrile);azane;1,3-xylene |
| PubChem CID | 70638628 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | bis(acetonitrile);azane;1,3-xylene |
| SMILES | CC#N.CC#N.Cc1cccc(C)c1.N.N |
| InChI | InChI=1S/C8H10.2C2H3N.2H3N/c1-7-4-3-5-8(2)6-7;2*1-2-3;;/h3-6H,1-2H3;2*1H3;2*1H3 |
| InChIKey | FTFBSEZENSUKMC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(acetonitrile);azane;1,3-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(acetonitrile);azane;1,3-xylene?
The IUPAC name of bis(acetonitrile);azane;1,3-xylene (CID 70638628) is bis(acetonitrile);azane;1,3-xylene.
What is the SMILES notation for bis(acetonitrile);azane;1,3-xylene?
The canonical SMILES for bis(acetonitrile);azane;1,3-xylene is CC#N.CC#N.Cc1cccc(C)c1.N.N.
What is the InChIKey of bis(acetonitrile);azane;1,3-xylene?
The InChIKey is FTFBSEZENSUKMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.2C2H3N.2H3N/c1-7-4-3-5-8(2)6-7;2*1-2-3;;/h3-6H,1-2H3;2*1H3;2*1H3.
What are the key properties of bis(acetonitrile);azane;1,3-xylene?
bis(acetonitrile);azane;1,3-xylene has a molecular weight of 222.34 g/mol, XLogP of 3.69, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(acetonitrile);azane;1,3-xylene is sourced from PubChem (CID 70638628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).