About cyanic acid;1,3-xylene
cyanic acid;1,3-xylene (PubChem CID 174785758) has the molecular formula C10H12N2O2
and a molecular weight of 192.22 g/mol. Its IUPAC name is cyanic acid;1,3-xylene.
Molecular Properties
| Compound Name | cyanic acid;1,3-xylene |
| PubChem CID | 174785758 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | cyanic acid;1,3-xylene |
| SMILES | Cc1cccc(C)c1.N#CO.N#CO |
| InChI | InChI=1S/C8H10.2CHNO/c1-7-4-3-5-8(2)6-7;2*2-1-3/h3-6H,1-2H3;2*3H |
| InChIKey | GYNDHSHAYGDZQA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze cyanic acid;1,3-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanic acid;1,3-xylene?
The IUPAC name of cyanic acid;1,3-xylene (CID 174785758) is cyanic acid;1,3-xylene.
What is the SMILES notation for cyanic acid;1,3-xylene?
The canonical SMILES for cyanic acid;1,3-xylene is Cc1cccc(C)c1.N#CO.N#CO.
What is the InChIKey of cyanic acid;1,3-xylene?
The InChIKey is GYNDHSHAYGDZQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.2CHNO/c1-7-4-3-5-8(2)6-7;2*2-1-3/h3-6H,1-2H3;2*3H.
What are the key properties of cyanic acid;1,3-xylene?
cyanic acid;1,3-xylene has a molecular weight of 192.22 g/mol, XLogP of 1.98, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyanic acid;1,3-xylene is sourced from PubChem (CID 174785758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).