C20H36 — CID 161051420
methane;1,3-xylene;1,4-xylene (PubChem CID 161051420) has the molecular formula C20H36 and a molecular weight of 276.51 g/mol. Its IUPAC name is methane;1,3-xylene;1,4-xylene.
| Compound Name | methane;1,3-xylene;1,4-xylene |
|---|---|
| PubChem CID | 161051420 |
| Molecular Formula | C20H36 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.28 |
| IUPAC Name | methane;1,3-xylene;1,4-xylene |
| SMILES | C.C.C.C.Cc1ccc(C)cc1.Cc1cccc(C)c1 |
| InChI | InChI=1S/2C8H10.4CH4/c1-7-3-5-8(2)6-4-7;1-7-4-3-5-8(2)6-7;;;;/h2*3-6H,1-2H3;4*1H4 |
| InChIKey | UCEOIXWYACVOMN-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |