C22H38 — CID 159094623
butane;methane;1,3-xylene;1,4-xylene (PubChem CID 159094623) has the molecular formula C22H38 and a molecular weight of 302.55 g/mol. Its IUPAC name is butane;methane;1,3-xylene;1,4-xylene.
| Compound Name | butane;methane;1,3-xylene;1,4-xylene |
|---|---|
| PubChem CID | 159094623 |
| Molecular Formula | C22H38 |
| Molecular Weight | 302.55 g/mol |
| Exact Mass | 302.30 |
| IUPAC Name | butane;methane;1,3-xylene;1,4-xylene |
| SMILES | C.C.CCCC.Cc1ccc(C)cc1.Cc1cccc(C)c1 |
| InChI | InChI=1S/2C8H10.C4H10.2CH4/c1-7-3-5-8(2)6-4-7;1-7-4-3-5-8(2)6-7;1-3-4-2;;/h2*3-6H,1-2H3;3-4H2,1-2H3;2*1H4 |
| InChIKey | KCMVWSCIKMLPHU-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.55 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |