C22H36 — CID 153377631
propane;1,2-xylene;1,3-xylene (PubChem CID 153377631) has the molecular formula C22H36 and a molecular weight of 300.53 g/mol. Its IUPAC name is propane;1,2-xylene;1,3-xylene.
| Compound Name | propane;1,2-xylene;1,3-xylene |
|---|---|
| PubChem CID | 153377631 |
| Molecular Formula | C22H36 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | propane;1,2-xylene;1,3-xylene |
| SMILES | CCC.CCC.Cc1cccc(C)c1.Cc1ccccc1C |
| InChI | InChI=1S/2C8H10.2C3H8/c1-7-4-3-5-8(2)6-7;1-7-5-3-4-6-8(7)2;2*1-3-2/h2*3-6H,1-2H3;2*3H2,1-2H3 |
| InChIKey | IIAHIUWBRMGZRI-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |