C24H32 — CID 164863410
1,4-dimethylcyclohexa-1,3-diene;1,2-xylene;1,3-xylene (PubChem CID 164863410) has the molecular formula C24H32 and a molecular weight of 320.52 g/mol. Its IUPAC name is 1,4-dimethylcyclohexa-1,3-diene;1,2-xylene;1,3-xylene.
| Compound Name | 1,4-dimethylcyclohexa-1,3-diene;1,2-xylene;1,3-xylene |
|---|---|
| PubChem CID | 164863410 |
| Molecular Formula | C24H32 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | 1,4-dimethylcyclohexa-1,3-diene;1,2-xylene;1,3-xylene |
| SMILES | CC1=CC=C(C)CC1.Cc1cccc(C)c1.Cc1ccccc1C |
| InChI | InChI=1S/C8H12.2C8H10/c1-7-3-5-8(2)6-4-7;1-7-4-3-5-8(2)6-7;1-7-5-3-4-6-8(7)2/h3,5H,4,6H2,1-2H3;2*3-6H,1-2H3 |
| InChIKey | SMXDQZFZDIOITC-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |