C16H22 — CID 142004310
1,4-dimethylcyclohexa-1,3-diene;1,4-xylene (PubChem CID 142004310) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is 1,4-dimethylcyclohexa-1,3-diene;1,4-xylene.
| Compound Name | 1,4-dimethylcyclohexa-1,3-diene;1,4-xylene |
|---|---|
| PubChem CID | 142004310 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 1,4-dimethylcyclohexa-1,3-diene;1,4-xylene |
| SMILES | CC1=CC=C(C)CC1.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C8H12.C8H10/c2*1-7-3-5-8(2)6-4-7/h3,5H,4,6H2,1-2H3;3-6H,1-2H3 |
| InChIKey | LGQPTPXKJQGOSZ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |