C39H48 — CID 174313619
ethylbenzene;toluene;1,2-xylene;1,3-xylene;1,4-xylene (PubChem CID 174313619) has the molecular formula C39H48 and a molecular weight of 516.81 g/mol. Its IUPAC name is ethylbenzene;toluene;1,2-xylene;1,3-xylene;1,4-xylene.
| Compound Name | ethylbenzene;toluene;1,2-xylene;1,3-xylene;1,4-xylene |
|---|---|
| PubChem CID | 174313619 |
| Molecular Formula | C39H48 |
| Molecular Weight | 516.81 g/mol |
| Exact Mass | 516.38 |
| IUPAC Name | ethylbenzene;toluene;1,2-xylene;1,3-xylene;1,4-xylene |
| SMILES | CCc1ccccc1.Cc1ccc(C)cc1.Cc1cccc(C)c1.Cc1ccccc1.Cc1ccccc1C |
| InChI | InChI=1S/4C8H10.C7H8/c1-7-3-5-8(2)6-4-7;1-7-4-3-5-8(2)6-7;1-7-5-3-4-6-8(7)2;1-2-8-6-4-3-5-7-8;1-7-5-3-2-4-6-7/h3*3-6H,1-2H3;3-7H,2H2,1H3;2-6H,1H3 |
| InChIKey | PURRFMOBTNPGMY-UHFFFAOYSA-N |
| XLogP | 11.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.81 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |