C31H50 — CID 158740154
1,3-diethylbenzene;1,4-diethylbenzene;methane;1,4-xylene (PubChem CID 158740154) has the molecular formula C31H50 and a molecular weight of 422.74 g/mol. Its IUPAC name is 1,3-diethylbenzene;1,4-diethylbenzene;methane;1,4-xylene.
| Compound Name | 1,3-diethylbenzene;1,4-diethylbenzene;methane;1,4-xylene |
|---|---|
| PubChem CID | 158740154 |
| Molecular Formula | C31H50 |
| Molecular Weight | 422.74 g/mol |
| Exact Mass | 422.39 |
| IUPAC Name | 1,3-diethylbenzene;1,4-diethylbenzene;methane;1,4-xylene |
| SMILES | C.C.C.CCc1ccc(CC)cc1.CCc1cccc(CC)c1.Cc1ccc(C)cc1 |
| InChI | InChI=1S/2C10H14.C8H10.3CH4/c1-3-9-5-7-10(4-2)8-6-9;1-3-9-6-5-7-10(4-2)8-9;1-7-3-5-8(2)6-4-7;;;/h2*5-8H,3-4H2,1-2H3;3-6H,1-2H3;3*1H4 |
| InChIKey | IMEPOWFGJDRZHX-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.74 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |