About 1-ethyl-4-methylbenzene;propane
1-ethyl-4-methylbenzene;propane (PubChem CID 144580802) has the molecular formula C18H36
and a molecular weight of 252.49 g/mol. Its IUPAC name is 1-ethyl-4-methylbenzene;propane.
Molecular Properties
| Compound Name | 1-ethyl-4-methylbenzene;propane |
| PubChem CID | 144580802 |
| Molecular Formula | C18H36 |
| Molecular Weight | 252.49 g/mol |
| Exact Mass | 252.28 |
| IUPAC Name | 1-ethyl-4-methylbenzene;propane |
| SMILES | CCC.CCC.CCC.CCc1ccc(C)cc1 |
| InChI | InChI=1S/C9H12.3C3H8/c1-3-9-6-4-8(2)5-7-9;3*1-3-2/h4-7H,3H2,1-2H3;3*3H2,1-2H3 |
| InChIKey | IGXTUHQNERNJBS-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.49 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-ethyl-4-methylbenzene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-methylbenzene;propane?
The IUPAC name of 1-ethyl-4-methylbenzene;propane (CID 144580802) is 1-ethyl-4-methylbenzene;propane.
What is the SMILES notation for 1-ethyl-4-methylbenzene;propane?
The canonical SMILES for 1-ethyl-4-methylbenzene;propane is CCC.CCC.CCC.CCc1ccc(C)cc1.
What is the InChIKey of 1-ethyl-4-methylbenzene;propane?
The InChIKey is IGXTUHQNERNJBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.3C3H8/c1-3-9-6-4-8(2)5-7-9;3*1-3-2/h4-7H,3H2,1-2H3;3*3H2,1-2H3.
What are the key properties of 1-ethyl-4-methylbenzene;propane?
1-ethyl-4-methylbenzene;propane has a molecular weight of 252.49 g/mol, XLogP of 6.81, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-methylbenzene;propane is sourced from PubChem (CID 144580802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).