C13H26 — CID 143560264
methane;propane;1,4-xylene (PubChem CID 143560264) has the molecular formula C13H26 and a molecular weight of 182.35 g/mol. Its IUPAC name is methane;propane;1,4-xylene.
| Compound Name | methane;propane;1,4-xylene |
|---|---|
| PubChem CID | 143560264 |
| Molecular Formula | C13H26 |
| Molecular Weight | 182.35 g/mol |
| Exact Mass | 182.20 |
| IUPAC Name | methane;propane;1,4-xylene |
| SMILES | C.C.CCC.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C8H10.C3H8.2CH4/c1-7-3-5-8(2)6-4-7;1-3-2;;/h3-6H,1-2H3;3H2,1-2H3;2*1H4 |
| InChIKey | BGBRAICKLSCASU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.35 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |