About methane;propane;1,4-xylene
methane;propane;1,4-xylene (PubChem CID 160778309) has the molecular formula C25H62
and a molecular weight of 362.77 g/mol. Its IUPAC name is methane;propane;1,4-xylene.
Molecular Properties
| Compound Name | methane;propane;1,4-xylene |
| PubChem CID | 160778309 |
| Molecular Formula | C25H62 |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 362.49 |
| IUPAC Name | methane;propane;1,4-xylene |
| SMILES | C.C.C.C.C.CCC.CCC.CCC.CCC.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C8H10.4C3H8.5CH4/c1-7-3-5-8(2)6-4-7;4*1-3-2;;;;;/h3-6H,1-2H3;4*3H2,1-2H3;5*1H4 |
| InChIKey | SAFYSPBCBQMUQN-UHFFFAOYSA-N |
| XLogP | 11.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze methane;propane;1,4-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;propane;1,4-xylene?
The IUPAC name of methane;propane;1,4-xylene (CID 160778309) is methane;propane;1,4-xylene.
What is the SMILES notation for methane;propane;1,4-xylene?
The canonical SMILES for methane;propane;1,4-xylene is C.C.C.C.C.CCC.CCC.CCC.CCC.Cc1ccc(C)cc1.
What is the InChIKey of methane;propane;1,4-xylene?
The InChIKey is SAFYSPBCBQMUQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.4C3H8.5CH4/c1-7-3-5-8(2)6-4-7;4*1-3-2;;;;;/h3-6H,1-2H3;4*3H2,1-2H3;5*1H4.
What are the key properties of methane;propane;1,4-xylene?
methane;propane;1,4-xylene has a molecular weight of 362.77 g/mol, XLogP of 11.15, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;propane;1,4-xylene is sourced from PubChem (CID 160778309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).