C11H20O2 — CID 70196397
ethanol;methanol;1,4-xylene (PubChem CID 70196397) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is ethanol;methanol;1,4-xylene.
| Compound Name | ethanol;methanol;1,4-xylene |
|---|---|
| PubChem CID | 70196397 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | ethanol;methanol;1,4-xylene |
| SMILES | CCO.CO.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C8H10.C2H6O.CH4O/c1-7-3-5-8(2)6-4-7;1-2-3;1-2/h3-6H,1-2H3;3H,2H2,1H3;2H,1H3 |
| InChIKey | IFGLUIGIOWDREI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |