C28H43NO — CID 143762169
ethane;methanol;4-methyl-N,N-bis(4-methylphenyl)aniline (PubChem CID 143762169) has the molecular formula C28H43NO and a molecular weight of 409.66 g/mol. Its IUPAC name is ethane;methanol;4-methyl-N,N-bis(4-methylphenyl)aniline.
| Compound Name | ethane;methanol;4-methyl-N,N-bis(4-methylphenyl)aniline |
|---|---|
| PubChem CID | 143762169 |
| Molecular Formula | C28H43NO |
| Molecular Weight | 409.66 g/mol |
| Exact Mass | 409.33 |
| IUPAC Name | ethane;methanol;4-methyl-N,N-bis(4-methylphenyl)aniline |
| SMILES | CC.CC.CC.CO.Cc1ccc(N(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H21N.3C2H6.CH4O/c1-16-4-10-19(11-5-16)22(20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21;4*1-2/h4-15H,1-3H3;3*1-2H3;2H,1H3 |
| InChIKey | BBPCEVCFCUDOOL-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.66 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |