About ethane;methanol;1,4-xylene
ethane;methanol;1,4-xylene (PubChem CID 171074418) has the molecular formula C13H26O
and a molecular weight of 198.35 g/mol. Its IUPAC name is ethane;methanol;1,4-xylene.
Molecular Properties
| Compound Name | ethane;methanol;1,4-xylene |
| PubChem CID | 171074418 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | ethane;methanol;1,4-xylene |
| SMILES | CC.CC.CO.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C8H10.2C2H6.CH4O/c1-7-3-5-8(2)6-4-7;3*1-2/h3-6H,1-2H3;2*1-2H3;2H,1H3 |
| InChIKey | FQYLGSDIOSCHEJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;methanol;1,4-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanol;1,4-xylene?
The IUPAC name of ethane;methanol;1,4-xylene (CID 171074418) is ethane;methanol;1,4-xylene.
What is the SMILES notation for ethane;methanol;1,4-xylene?
The canonical SMILES for ethane;methanol;1,4-xylene is CC.CC.CO.Cc1ccc(C)cc1.
What is the InChIKey of ethane;methanol;1,4-xylene?
The InChIKey is FQYLGSDIOSCHEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.2C2H6.CH4O/c1-7-3-5-8(2)6-4-7;3*1-2/h3-6H,1-2H3;2*1-2H3;2H,1H3.
What are the key properties of ethane;methanol;1,4-xylene?
ethane;methanol;1,4-xylene has a molecular weight of 198.35 g/mol, XLogP of 3.96, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanol;1,4-xylene is sourced from PubChem (CID 171074418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).