About ethane;4-(4-methylphenyl)phenol
ethane;4-(4-methylphenyl)phenol (PubChem CID 161379556) has the molecular formula C17H24O
and a molecular weight of 244.38 g/mol. Its IUPAC name is ethane;4-(4-methylphenyl)phenol.
Molecular Properties
| Compound Name | ethane;4-(4-methylphenyl)phenol |
| PubChem CID | 161379556 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | ethane;4-(4-methylphenyl)phenol |
| SMILES | CC.CC.Cc1ccc(-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C13H12O.2C2H6/c1-10-2-4-11(5-3-10)12-6-8-13(14)9-7-12;2*1-2/h2-9,14H,1H3;2*1-2H3 |
| InChIKey | VRNREAVNWZKLOX-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;4-(4-methylphenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-(4-methylphenyl)phenol?
The IUPAC name of ethane;4-(4-methylphenyl)phenol (CID 161379556) is ethane;4-(4-methylphenyl)phenol.
What is the SMILES notation for ethane;4-(4-methylphenyl)phenol?
The canonical SMILES for ethane;4-(4-methylphenyl)phenol is CC.CC.Cc1ccc(-c2ccc(O)cc2)cc1.
What is the InChIKey of ethane;4-(4-methylphenyl)phenol?
The InChIKey is VRNREAVNWZKLOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O.2C2H6/c1-10-2-4-11(5-3-10)12-6-8-13(14)9-7-12;2*1-2/h2-9,14H,1H3;2*1-2H3.
What are the key properties of ethane;4-(4-methylphenyl)phenol?
ethane;4-(4-methylphenyl)phenol has a molecular weight of 244.38 g/mol, XLogP of 5.42, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-(4-methylphenyl)phenol is sourced from PubChem (CID 161379556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).