About 4-methylphenol;prop-1-yne
4-methylphenol;prop-1-yne (PubChem CID 158792009) has the molecular formula C10H12O
and a molecular weight of 148.20 g/mol. Its IUPAC name is 4-methylphenol;prop-1-yne.
Molecular Properties
| Compound Name | 4-methylphenol;prop-1-yne |
| PubChem CID | 158792009 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 4-methylphenol;prop-1-yne |
| SMILES | C#CC.Cc1ccc(O)cc1 |
| InChI | InChI=1S/C7H8O.C3H4/c1-6-2-4-7(8)5-3-6;1-3-2/h2-5,8H,1H3;1H,2H3 |
| InChIKey | ISJYLNPHINPZKC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methylphenol;prop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylphenol;prop-1-yne?
The IUPAC name of 4-methylphenol;prop-1-yne (CID 158792009) is 4-methylphenol;prop-1-yne.
What is the SMILES notation for 4-methylphenol;prop-1-yne?
The canonical SMILES for 4-methylphenol;prop-1-yne is C#CC.Cc1ccc(O)cc1.
What is the InChIKey of 4-methylphenol;prop-1-yne?
The InChIKey is ISJYLNPHINPZKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C3H4/c1-6-2-4-7(8)5-3-6;1-3-2/h2-5,8H,1H3;1H,2H3.
What are the key properties of 4-methylphenol;prop-1-yne?
4-methylphenol;prop-1-yne has a molecular weight of 148.20 g/mol, XLogP of 2.34, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylphenol;prop-1-yne is sourced from PubChem (CID 158792009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).