About 4-methylphenol
4-methylphenol (PubChem CID 70549076) has the molecular formula C21H24O3
and a molecular weight of 324.42 g/mol. Its IUPAC name is 4-methylphenol.
Molecular Properties
| Compound Name | 4-methylphenol |
| PubChem CID | 70549076 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 4-methylphenol |
| SMILES | Cc1ccc(O)cc1.Cc1ccc(O)cc1.Cc1ccc(O)cc1 |
| InChI | InChI=1S/3C7H8O/c3*1-6-2-4-7(8)5-3-6/h3*2-5,8H,1H3 |
| InChIKey | NYDKJMXPJFOLCW-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylphenol?
The IUPAC name of 4-methylphenol (CID 70549076) is 4-methylphenol.
What is the SMILES notation for 4-methylphenol?
The canonical SMILES for 4-methylphenol is Cc1ccc(O)cc1.Cc1ccc(O)cc1.Cc1ccc(O)cc1.
What is the InChIKey of 4-methylphenol?
The InChIKey is NYDKJMXPJFOLCW-UHFFFAOYSA-N. The full InChI is InChI=1S/3C7H8O/c3*1-6-2-4-7(8)5-3-6/h3*2-5,8H,1H3.
What are the key properties of 4-methylphenol?
4-methylphenol has a molecular weight of 324.42 g/mol, XLogP of 5.10, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylphenol is sourced from PubChem (CID 70549076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).