About 4-methylphenol;propan-2-ylphosphane
4-methylphenol;propan-2-ylphosphane (PubChem CID 144779899) has the molecular formula C10H17OP
and a molecular weight of 184.22 g/mol. Its IUPAC name is 4-methylphenol;propan-2-ylphosphane.
Molecular Properties
| Compound Name | 4-methylphenol;propan-2-ylphosphane |
| PubChem CID | 144779899 |
| Molecular Formula | C10H17OP |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 4-methylphenol;propan-2-ylphosphane |
| SMILES | CC(C)P.Cc1ccc(O)cc1 |
| InChI | InChI=1S/C7H8O.C3H9P/c1-6-2-4-7(8)5-3-6;1-3(2)4/h2-5,8H,1H3;3H,4H2,1-2H3 |
| InChIKey | AORJVNQZTXNKMZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-methylphenol;propan-2-ylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylphenol;propan-2-ylphosphane?
The IUPAC name of 4-methylphenol;propan-2-ylphosphane (CID 144779899) is 4-methylphenol;propan-2-ylphosphane.
What is the SMILES notation for 4-methylphenol;propan-2-ylphosphane?
The canonical SMILES for 4-methylphenol;propan-2-ylphosphane is CC(C)P.Cc1ccc(O)cc1.
What is the InChIKey of 4-methylphenol;propan-2-ylphosphane?
The InChIKey is AORJVNQZTXNKMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C3H9P/c1-6-2-4-7(8)5-3-6;1-3(2)4/h2-5,8H,1H3;3H,4H2,1-2H3.
What are the key properties of 4-methylphenol;propan-2-ylphosphane?
4-methylphenol;propan-2-ylphosphane has a molecular weight of 184.22 g/mol, XLogP of 2.97, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylphenol;propan-2-ylphosphane is sourced from PubChem (CID 144779899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).