About 4-methylphenol;2-methylpropane
4-methylphenol;2-methylpropane (PubChem CID 91606636) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is 4-methylphenol;2-methylpropane.
Molecular Properties
| Compound Name | 4-methylphenol;2-methylpropane |
| PubChem CID | 91606636 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 4-methylphenol;2-methylpropane |
| SMILES | CC(C)C.Cc1ccc(O)cc1 |
| InChI | InChI=1S/C7H8O.C4H10/c1-6-2-4-7(8)5-3-6;1-4(2)3/h2-5,8H,1H3;4H,1-3H3 |
| InChIKey | GZWSWEPUHQQDAA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methylphenol;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylphenol;2-methylpropane?
The IUPAC name of 4-methylphenol;2-methylpropane (CID 91606636) is 4-methylphenol;2-methylpropane.
What is the SMILES notation for 4-methylphenol;2-methylpropane?
The canonical SMILES for 4-methylphenol;2-methylpropane is CC(C)C.Cc1ccc(O)cc1.
What is the InChIKey of 4-methylphenol;2-methylpropane?
The InChIKey is GZWSWEPUHQQDAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C4H10/c1-6-2-4-7(8)5-3-6;1-4(2)3/h2-5,8H,1H3;4H,1-3H3.
What are the key properties of 4-methylphenol;2-methylpropane?
4-methylphenol;2-methylpropane has a molecular weight of 166.26 g/mol, XLogP of 3.36, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylphenol;2-methylpropane is sourced from PubChem (CID 91606636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).