About 4-methylphenol;pentan-2-ol
4-methylphenol;pentan-2-ol (PubChem CID 159232980) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is 4-methylphenol;pentan-2-ol.
Molecular Properties
| Compound Name | 4-methylphenol;pentan-2-ol |
| PubChem CID | 159232980 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 4-methylphenol;pentan-2-ol |
| SMILES | CCCC(C)O.Cc1ccc(O)cc1 |
| InChI | InChI=1S/C7H8O.C5H12O/c1-6-2-4-7(8)5-3-6;1-3-4-5(2)6/h2-5,8H,1H3;5-6H,3-4H2,1-2H3 |
| InChIKey | KTDBPUJNOIIAKR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylphenol;pentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylphenol;pentan-2-ol?
The IUPAC name of 4-methylphenol;pentan-2-ol (CID 159232980) is 4-methylphenol;pentan-2-ol.
What is the SMILES notation for 4-methylphenol;pentan-2-ol?
The canonical SMILES for 4-methylphenol;pentan-2-ol is CCCC(C)O.Cc1ccc(O)cc1.
What is the InChIKey of 4-methylphenol;pentan-2-ol?
The InChIKey is KTDBPUJNOIIAKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C5H12O/c1-6-2-4-7(8)5-3-6;1-3-4-5(2)6/h2-5,8H,1H3;5-6H,3-4H2,1-2H3.
What are the key properties of 4-methylphenol;pentan-2-ol?
4-methylphenol;pentan-2-ol has a molecular weight of 196.29 g/mol, XLogP of 2.87, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylphenol;pentan-2-ol is sourced from PubChem (CID 159232980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).