About butane;3-methylheptane;4-methylphenol
butane;3-methylheptane;4-methylphenol (PubChem CID 155694275) has the molecular formula C19H36O
and a molecular weight of 280.50 g/mol. Its IUPAC name is butane;3-methylheptane;4-methylphenol.
Molecular Properties
| Compound Name | butane;3-methylheptane;4-methylphenol |
| PubChem CID | 155694275 |
| Molecular Formula | C19H36O |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.28 |
| IUPAC Name | butane;3-methylheptane;4-methylphenol |
| SMILES | CCCC.CCCCC(C)CC.Cc1ccc(O)cc1 |
| InChI | InChI=1S/C8H18.C7H8O.C4H10/c1-4-6-7-8(3)5-2;1-6-2-4-7(8)5-3-6;1-3-4-2/h8H,4-7H2,1-3H3;2-5,8H,1H3;3-4H2,1-2H3 |
| InChIKey | KQMBSEXVIFYDPT-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butane;3-methylheptane;4-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;3-methylheptane;4-methylphenol?
The IUPAC name of butane;3-methylheptane;4-methylphenol (CID 155694275) is butane;3-methylheptane;4-methylphenol.
What is the SMILES notation for butane;3-methylheptane;4-methylphenol?
The canonical SMILES for butane;3-methylheptane;4-methylphenol is CCCC.CCCCC(C)CC.Cc1ccc(O)cc1.
What is the InChIKey of butane;3-methylheptane;4-methylphenol?
The InChIKey is KQMBSEXVIFYDPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.C7H8O.C4H10/c1-4-6-7-8(3)5-2;1-6-2-4-7(8)5-3-6;1-3-4-2/h8H,4-7H2,1-3H3;2-5,8H,1H3;3-4H2,1-2H3.
What are the key properties of butane;3-methylheptane;4-methylphenol?
butane;3-methylheptane;4-methylphenol has a molecular weight of 280.50 g/mol, XLogP of 6.73, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;3-methylheptane;4-methylphenol is sourced from PubChem (CID 155694275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).