About 2-methylhexane;4-methylphenol
2-methylhexane;4-methylphenol (PubChem CID 144980508) has the molecular formula C14H24O
and a molecular weight of 208.34 g/mol. Its IUPAC name is 2-methylhexane;4-methylphenol.
Molecular Properties
| Compound Name | 2-methylhexane;4-methylphenol |
| PubChem CID | 144980508 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 2-methylhexane;4-methylphenol |
| SMILES | CCCCC(C)C.Cc1ccc(O)cc1 |
| InChI | InChI=1S/C7H8O.C7H16/c1-6-2-4-7(8)5-3-6;1-4-5-6-7(2)3/h2-5,8H,1H3;7H,4-6H2,1-3H3 |
| InChIKey | AUOOEAGEZFZZLO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylhexane;4-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhexane;4-methylphenol?
The IUPAC name of 2-methylhexane;4-methylphenol (CID 144980508) is 2-methylhexane;4-methylphenol.
What is the SMILES notation for 2-methylhexane;4-methylphenol?
The canonical SMILES for 2-methylhexane;4-methylphenol is CCCCC(C)C.Cc1ccc(O)cc1.
What is the InChIKey of 2-methylhexane;4-methylphenol?
The InChIKey is AUOOEAGEZFZZLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C7H16/c1-6-2-4-7(8)5-3-6;1-4-5-6-7(2)3/h2-5,8H,1H3;7H,4-6H2,1-3H3.
What are the key properties of 2-methylhexane;4-methylphenol?
2-methylhexane;4-methylphenol has a molecular weight of 208.34 g/mol, XLogP of 4.53, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhexane;4-methylphenol is sourced from PubChem (CID 144980508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).