About 3-butyl-4-methylphenol;2-methylhexane
3-butyl-4-methylphenol;2-methylhexane (PubChem CID 142056802) has the molecular formula C18H32O
and a molecular weight of 264.45 g/mol. Its IUPAC name is 3-butyl-4-methylphenol;2-methylhexane.
Molecular Properties
| Compound Name | 3-butyl-4-methylphenol;2-methylhexane |
| PubChem CID | 142056802 |
| Molecular Formula | C18H32O |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | 3-butyl-4-methylphenol;2-methylhexane |
| SMILES | CCCCC(C)C.CCCCc1cc(O)ccc1C |
| InChI | InChI=1S/C11H16O.C7H16/c1-3-4-5-10-8-11(12)7-6-9(10)2;1-4-5-6-7(2)3/h6-8,12H,3-5H2,1-2H3;7H,4-6H2,1-3H3 |
| InChIKey | ZETDQOZZRGLPPI-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-butyl-4-methylphenol;2-methylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-4-methylphenol;2-methylhexane?
The IUPAC name of 3-butyl-4-methylphenol;2-methylhexane (CID 142056802) is 3-butyl-4-methylphenol;2-methylhexane.
What is the SMILES notation for 3-butyl-4-methylphenol;2-methylhexane?
The canonical SMILES for 3-butyl-4-methylphenol;2-methylhexane is CCCCC(C)C.CCCCc1cc(O)ccc1C.
What is the InChIKey of 3-butyl-4-methylphenol;2-methylhexane?
The InChIKey is ZETDQOZZRGLPPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O.C7H16/c1-3-4-5-10-8-11(12)7-6-9(10)2;1-4-5-6-7(2)3/h6-8,12H,3-5H2,1-2H3;7H,4-6H2,1-3H3.
What are the key properties of 3-butyl-4-methylphenol;2-methylhexane?
3-butyl-4-methylphenol;2-methylhexane has a molecular weight of 264.45 g/mol, XLogP of 5.88, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-4-methylphenol;2-methylhexane is sourced from PubChem (CID 142056802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).