About 4-bromo-3-hexylphenol
4-bromo-3-hexylphenol (PubChem CID 15007737) has the molecular formula C12H17BrO
and a molecular weight of 257.17 g/mol. Its IUPAC name is 4-bromo-3-hexylphenol.
Molecular Properties
| Compound Name | 4-bromo-3-hexylphenol |
| PubChem CID | 15007737 |
| Molecular Formula | C12H17BrO |
| Molecular Weight | 257.17 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 4-bromo-3-hexylphenol |
| SMILES | CCCCCCc1cc(O)ccc1Br |
| InChI | InChI=1S/C12H17BrO/c1-2-3-4-5-6-10-9-11(14)7-8-12(10)13/h7-9,14H,2-6H2,1H3 |
| InChIKey | SSYBIGLGOJWRHE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.17 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-3-hexylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-hexylphenol?
The IUPAC name of 4-bromo-3-hexylphenol (CID 15007737) is 4-bromo-3-hexylphenol.
What is the SMILES notation for 4-bromo-3-hexylphenol?
The canonical SMILES for 4-bromo-3-hexylphenol is CCCCCCc1cc(O)ccc1Br.
What is the InChIKey of 4-bromo-3-hexylphenol?
The InChIKey is SSYBIGLGOJWRHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17BrO/c1-2-3-4-5-6-10-9-11(14)7-8-12(10)13/h7-9,14H,2-6H2,1H3.
What are the key properties of 4-bromo-3-hexylphenol?
4-bromo-3-hexylphenol has a molecular weight of 257.17 g/mol, XLogP of 4.28, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-hexylphenol is sourced from PubChem (CID 15007737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).