C17H26Br2 — CID 146208294
1,4-dibromo-2-hexyl-5-pentylbenzene (PubChem CID 146208294) has the molecular formula C17H26Br2 and a molecular weight of 390.20 g/mol. Its IUPAC name is 1,4-dibromo-2-hexyl-5-pentylbenzene.
| Compound Name | 1,4-dibromo-2-hexyl-5-pentylbenzene |
|---|---|
| PubChem CID | 146208294 |
| Molecular Formula | C17H26Br2 |
| Molecular Weight | 390.20 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 1,4-dibromo-2-hexyl-5-pentylbenzene |
| SMILES | CCCCCCc1cc(Br)c(CCCCC)cc1Br |
| InChI | InChI=1S/C17H26Br2/c1-3-5-7-9-11-15-13-16(18)14(12-17(15)19)10-8-6-4-2/h12-13H,3-11H2,1-2H3 |
| InChIKey | FTUHHISVKVKKHH-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.20 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|