C43H65BrSi — CID 10747186
2-[4-[2-(4-bromo-2,5-dihexylphenyl)ethynyl]-2,5-dihexylphenyl]ethynyl-trimethylsilane (PubChem CID 10747186) has the molecular formula C43H65BrSi and a molecular weight of 689.98 g/mol. Its IUPAC name is 2-[4-[2-(4-bromo-2,5-dihexylphenyl)ethynyl]-2,5-dihexylphenyl]ethynyl-trimethylsilane.
| Compound Name | 2-[4-[2-(4-bromo-2,5-dihexylphenyl)ethynyl]-2,5-dihexylphenyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 10747186 |
| Molecular Formula | C43H65BrSi |
| Molecular Weight | 689.98 g/mol |
| Exact Mass | 688.40 |
| IUPAC Name | 2-[4-[2-(4-bromo-2,5-dihexylphenyl)ethynyl]-2,5-dihexylphenyl]ethynyl-trimethylsilane |
| SMILES | CCCCCCc1cc(C#Cc2cc(CCCCCC)c(C#C[Si](C)(C)C)cc2CCCCCC)c(CCCCCC)cc1Br |
| InChI | InChI=1S/C43H65BrSi/c1-8-12-16-20-24-36-33-41(30-31-45(5,6)7)37(25-21-17-13-9-2)32-39(36)28-29-40-34-42(27-23-19-15-11-4)43(44)35-38(40)26-22-18-14-10-3/h32-35H,8-27H2,1-7H3 |
| InChIKey | AKMOOYGSOHYCMG-UHFFFAOYSA-N |
| XLogP | 13.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.98 |
| LogP ≤ 5 | 13.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|