C50H74Si2 — CID 10372779
2-[2-[4-[4,5-dihexyl-2-(2-trimethylsilylethynyl)phenyl]buta-1,3-diynyl]-4,5-dihexylphenyl]ethynyl-trimethylsilane (PubChem CID 10372779) has the molecular formula C50H74Si2 and a molecular weight of 731.31 g/mol. Its IUPAC name is 2-[2-[4-[4,5-dihexyl-2-(2-trimethylsilylethynyl)phenyl]buta-1,3-diynyl]-4,5-dihexylphenyl]ethynyl-trimethylsilane.
| Compound Name | 2-[2-[4-[4,5-dihexyl-2-(2-trimethylsilylethynyl)phenyl]buta-1,3-diynyl]-4,5-dihexylphenyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 10372779 |
| Molecular Formula | C50H74Si2 |
| Molecular Weight | 731.31 g/mol |
| Exact Mass | 730.53 |
| IUPAC Name | 2-[2-[4-[4,5-dihexyl-2-(2-trimethylsilylethynyl)phenyl]buta-1,3-diynyl]-4,5-dihexylphenyl]ethynyl-trimethylsilane |
| SMILES | CCCCCCc1cc(C#CC#Cc2cc(CCCCCC)c(CCCCCC)cc2C#C[Si](C)(C)C)c(C#C[Si](C)(C)C)cc1CCCCCC |
| InChI | InChI=1S/C50H74Si2/c1-11-15-19-23-29-43-39-47(49(35-37-51(5,6)7)41-45(43)31-25-21-17-13-3)33-27-28-34-48-40-44(30-24-20-16-12-2)46(32-26-22-18-14-4)42-50(48)36-38-52(8,9)10/h39-42H,11-26,29-32H2,1-10H3 |
| InChIKey | YBEKXPUPAHAREA-UHFFFAOYSA-N |
| XLogP | 14.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.31 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|