About 1,2-diethynyl-4,5-dihexylbenzene
1,2-diethynyl-4,5-dihexylbenzene (PubChem CID 10469738) has the molecular formula C22H30
and a molecular weight of 294.48 g/mol. Its IUPAC name is 1,2-diethynyl-4,5-dihexylbenzene.
Molecular Properties
| Compound Name | 1,2-diethynyl-4,5-dihexylbenzene |
| PubChem CID | 10469738 |
| Molecular Formula | C22H30 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 1,2-diethynyl-4,5-dihexylbenzene |
| SMILES | C#Cc1cc(CCCCCC)c(CCCCCC)cc1C#C |
| InChI | InChI=1S/C22H30/c1-5-9-11-13-15-21-17-19(7-3)20(8-4)18-22(21)16-14-12-10-6-2/h3-4,17-18H,5-6,9-16H2,1-2H3 |
| InChIKey | GRQUYKATGDIMOL-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diethynyl-4,5-dihexylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diethynyl-4,5-dihexylbenzene?
The IUPAC name of 1,2-diethynyl-4,5-dihexylbenzene (CID 10469738) is 1,2-diethynyl-4,5-dihexylbenzene.
What is the SMILES notation for 1,2-diethynyl-4,5-dihexylbenzene?
The canonical SMILES for 1,2-diethynyl-4,5-dihexylbenzene is C#Cc1cc(CCCCCC)c(CCCCCC)cc1C#C.
What is the InChIKey of 1,2-diethynyl-4,5-dihexylbenzene?
The InChIKey is GRQUYKATGDIMOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30/c1-5-9-11-13-15-21-17-19(7-3)20(8-4)18-22(21)16-14-12-10-6-2/h3-4,17-18H,5-6,9-16H2,1-2H3.
What are the key properties of 1,2-diethynyl-4,5-dihexylbenzene?
1,2-diethynyl-4,5-dihexylbenzene has a molecular weight of 294.48 g/mol, XLogP of 5.89, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diethynyl-4,5-dihexylbenzene is sourced from PubChem (CID 10469738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).