C20H29I — CID 10894555
1-ethynyl-2,5-dihexyl-4-iodobenzene (PubChem CID 10894555) has the molecular formula C20H29I and a molecular weight of 396.36 g/mol. Its IUPAC name is 1-ethynyl-2,5-dihexyl-4-iodobenzene.
| Compound Name | 1-ethynyl-2,5-dihexyl-4-iodobenzene |
|---|---|
| PubChem CID | 10894555 |
| Molecular Formula | C20H29I |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 1-ethynyl-2,5-dihexyl-4-iodobenzene |
| SMILES | C#Cc1cc(CCCCCC)c(I)cc1CCCCCC |
| InChI | InChI=1S/C20H29I/c1-4-7-9-11-13-18-16-20(21)19(15-17(18)6-3)14-12-10-8-5-2/h3,15-16H,4-5,7-14H2,1-2H3 |
| InChIKey | KLDCJUAUOVAFBI-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|