C24H30I2 — CID 176885795
2,3-dihexyl-6,7-diiodobiphenylene (PubChem CID 176885795) has the molecular formula C24H30I2 and a molecular weight of 572.31 g/mol. Its IUPAC name is 2,3-dihexyl-6,7-diiodobiphenylene.
| Compound Name | 2,3-dihexyl-6,7-diiodobiphenylene |
|---|---|
| PubChem CID | 176885795 |
| Molecular Formula | C24H30I2 |
| Molecular Weight | 572.31 g/mol |
| Exact Mass | 572.04 |
| IUPAC Name | 2,3-dihexyl-6,7-diiodobiphenylene |
| SMILES | CCCCCCc1cc2c(cc1CCCCCC)=c1cc(I)c(I)cc1=2 |
| InChI | InChI=1S/C24H30I2/c1-3-5-7-9-11-17-13-19-20(14-18(17)12-10-8-6-4-2)22-16-24(26)23(25)15-21(19)22/h13-16H,3-12H2,1-2H3 |
| InChIKey | BKWYDRUFLDSLKH-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.31 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|