C36H54I2N2 — CID 102461793
1,4,6,9-tetrahexyl-2,7-diiodophenazine (PubChem CID 102461793) has the molecular formula C36H54I2N2 and a molecular weight of 768.65 g/mol. Its IUPAC name is 1,4,6,9-tetrahexyl-2,7-diiodophenazine.
| Compound Name | 1,4,6,9-tetrahexyl-2,7-diiodophenazine |
|---|---|
| PubChem CID | 102461793 |
| Molecular Formula | C36H54I2N2 |
| Molecular Weight | 768.65 g/mol |
| Exact Mass | 768.24 |
| IUPAC Name | 1,4,6,9-tetrahexyl-2,7-diiodophenazine |
| SMILES | CCCCCCc1cc(I)c(CCCCCC)c2nc3c(CCCCCC)cc(I)c(CCCCCC)c3nc12 |
| InChI | InChI=1S/C36H54I2N2/c1-5-9-13-17-21-27-25-31(37)29(23-19-15-11-7-3)35-33(27)39-36-30(24-20-16-12-8-4)32(38)26-28(34(36)40-35)22-18-14-10-6-2/h25-26H,5-24H2,1-4H3 |
| InChIKey | MCUYTUPDKYUYAY-UHFFFAOYSA-N |
| XLogP | 12.48 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.65 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|