C22H25I — CID 86211963
1,4-dibutyl-2-iodo-5-(2-phenylethynyl)benzene (PubChem CID 86211963) has the molecular formula C22H25I and a molecular weight of 416.35 g/mol. Its IUPAC name is 1,4-dibutyl-2-iodo-5-(2-phenylethynyl)benzene.
| Compound Name | 1,4-dibutyl-2-iodo-5-(2-phenylethynyl)benzene |
|---|---|
| PubChem CID | 86211963 |
| Molecular Formula | C22H25I |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 1,4-dibutyl-2-iodo-5-(2-phenylethynyl)benzene |
| SMILES | CCCCc1cc(C#Cc2ccccc2)c(CCCC)cc1I |
| InChI | InChI=1S/C22H25I/c1-3-5-12-19-17-22(23)21(13-6-4-2)16-20(19)15-14-18-10-8-7-9-11-18/h7-11,16-17H,3-6,12-13H2,1-2H3 |
| InChIKey | MDMOZVVGDZHTHB-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|