C21H24O — CID 101034696
[5-hexyl-2-(2-phenylethynyl)phenyl]methanol (PubChem CID 101034696) has the molecular formula C21H24O and a molecular weight of 292.42 g/mol. Its IUPAC name is [5-hexyl-2-(2-phenylethynyl)phenyl]methanol.
| Compound Name | [5-hexyl-2-(2-phenylethynyl)phenyl]methanol |
|---|---|
| PubChem CID | 101034696 |
| Molecular Formula | C21H24O |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | [5-hexyl-2-(2-phenylethynyl)phenyl]methanol |
| SMILES | CCCCCCc1ccc(C#Cc2ccccc2)c(CO)c1 |
| InChI | InChI=1S/C21H24O/c1-2-3-4-6-11-19-13-15-20(21(16-19)17-22)14-12-18-9-7-5-8-10-18/h5,7-10,13,15-16,22H,2-4,6,11,17H2,1H3 |
| InChIKey | FMRMVNHCYUKBET-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|