C22H32N2 — CID 10947312
4,5-diheptylbenzene-1,2-dicarbonitrile (PubChem CID 10947312) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 4,5-diheptylbenzene-1,2-dicarbonitrile.
| Compound Name | 4,5-diheptylbenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 10947312 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | 4,5-diheptylbenzene-1,2-dicarbonitrile |
| SMILES | CCCCCCCc1cc(C#N)c(C#N)cc1CCCCCCC |
| InChI | InChI=1S/C22H32N2/c1-3-5-7-9-11-13-19-15-21(17-23)22(18-24)16-20(19)14-12-10-8-6-4-2/h15-16H,3-14H2,1-2H3 |
| InChIKey | RQLVZZOMORQKRT-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|