About 4-hexylbenzene-1,3-dicarbonitrile
4-hexylbenzene-1,3-dicarbonitrile (PubChem CID 54303199) has the molecular formula C14H16N2
and a molecular weight of 212.30 g/mol. Its IUPAC name is 4-hexylbenzene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 4-hexylbenzene-1,3-dicarbonitrile |
| PubChem CID | 54303199 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 4-hexylbenzene-1,3-dicarbonitrile |
| SMILES | CCCCCCc1ccc(C#N)cc1C#N |
| InChI | InChI=1S/C14H16N2/c1-2-3-4-5-6-13-8-7-12(10-15)9-14(13)11-16/h7-9H,2-6H2,1H3 |
| InChIKey | FVFAMDKCZBFMNQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-hexylbenzene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexylbenzene-1,3-dicarbonitrile?
The IUPAC name of 4-hexylbenzene-1,3-dicarbonitrile (CID 54303199) is 4-hexylbenzene-1,3-dicarbonitrile.
What is the SMILES notation for 4-hexylbenzene-1,3-dicarbonitrile?
The canonical SMILES for 4-hexylbenzene-1,3-dicarbonitrile is CCCCCCc1ccc(C#N)cc1C#N.
What is the InChIKey of 4-hexylbenzene-1,3-dicarbonitrile?
The InChIKey is FVFAMDKCZBFMNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2/c1-2-3-4-5-6-13-8-7-12(10-15)9-14(13)11-16/h7-9H,2-6H2,1H3.
What are the key properties of 4-hexylbenzene-1,3-dicarbonitrile?
4-hexylbenzene-1,3-dicarbonitrile has a molecular weight of 212.30 g/mol, XLogP of 3.55, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexylbenzene-1,3-dicarbonitrile is sourced from PubChem (CID 54303199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).