About ethane;methane;3-pentyl-1H-indole-5-carbonitrile
ethane;methane;3-pentyl-1H-indole-5-carbonitrile (PubChem CID 142891343) has the molecular formula C17H26N2
and a molecular weight of 258.41 g/mol. Its IUPAC name is ethane;methane;3-pentyl-1H-indole-5-carbonitrile.
Molecular Properties
| Compound Name | ethane;methane;3-pentyl-1H-indole-5-carbonitrile |
| PubChem CID | 142891343 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | ethane;methane;3-pentyl-1H-indole-5-carbonitrile |
| SMILES | C.CC.CCCCCc1c[nH]c2ccc(C#N)cc12 |
| InChI | InChI=1S/C14H16N2.C2H6.CH4/c1-2-3-4-5-12-10-16-14-7-6-11(9-15)8-13(12)14;1-2;/h6-8,10,16H,2-5H2,1H3;1-2H3;1H4 |
| InChIKey | CSTKSFBRJXLGHG-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;methane;3-pentyl-1H-indole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;3-pentyl-1H-indole-5-carbonitrile?
The IUPAC name of ethane;methane;3-pentyl-1H-indole-5-carbonitrile (CID 142891343) is ethane;methane;3-pentyl-1H-indole-5-carbonitrile.
What is the SMILES notation for ethane;methane;3-pentyl-1H-indole-5-carbonitrile?
The canonical SMILES for ethane;methane;3-pentyl-1H-indole-5-carbonitrile is C.CC.CCCCCc1c[nH]c2ccc(C#N)cc12.
What is the InChIKey of ethane;methane;3-pentyl-1H-indole-5-carbonitrile?
The InChIKey is CSTKSFBRJXLGHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2.C2H6.CH4/c1-2-3-4-5-12-10-16-14-7-6-11(9-15)8-13(12)14;1-2;/h6-8,10,16H,2-5H2,1H3;1-2H3;1H4.
What are the key properties of ethane;methane;3-pentyl-1H-indole-5-carbonitrile?
ethane;methane;3-pentyl-1H-indole-5-carbonitrile has a molecular weight of 258.41 g/mol, XLogP of 5.43, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;3-pentyl-1H-indole-5-carbonitrile is sourced from PubChem (CID 142891343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).