C24H25N5 — CID 10293352
3-[4-[4-(2-cyanophenyl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile (PubChem CID 10293352) has the molecular formula C24H25N5 and a molecular weight of 383.50 g/mol. Its IUPAC name is 3-[4-[4-(2-cyanophenyl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile.
| Compound Name | 3-[4-[4-(2-cyanophenyl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 10293352 |
| Molecular Formula | C24H25N5 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 3-[4-[4-(2-cyanophenyl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]cc(CCCCN3CCN(c4ccccc4C#N)CC3)c2c1 |
| InChI | InChI=1S/C24H25N5/c25-16-19-8-9-23-22(15-19)21(18-27-23)6-3-4-10-28-11-13-29(14-12-28)24-7-2-1-5-20(24)17-26/h1-2,5,7-9,15,18,27H,3-4,6,10-14H2 |
| InChIKey | BTXYAHWFEJNRAE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|