C23H26N4O2 — CID 57229461
3-[4-[4-(2,4-dihydroxyphenyl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile (PubChem CID 57229461) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 3-[4-[4-(2,4-dihydroxyphenyl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile.
| Compound Name | 3-[4-[4-(2,4-dihydroxyphenyl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 57229461 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 3-[4-[4-(2,4-dihydroxyphenyl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]cc(CCCCN3CCN(c4ccc(O)cc4O)CC3)c2c1 |
| InChI | InChI=1S/C23H26N4O2/c24-15-17-4-6-21-20(13-17)18(16-25-21)3-1-2-8-26-9-11-27(12-10-26)22-7-5-19(28)14-23(22)29/h4-7,13-14,16,25,28-29H,1-3,8-12H2 |
| InChIKey | SPVYUPIYKJXTLZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|