C27H35N5 — CID 141055672
3-[4-[4-[4-methyl-3-[2-(methylamino)ethyl]phenyl]piperazin-1-yl]butyl]-1H-indole-5-carbonitrile (PubChem CID 141055672) has the molecular formula C27H35N5 and a molecular weight of 429.61 g/mol. Its IUPAC name is 3-[4-[4-[4-methyl-3-[2-(methylamino)ethyl]phenyl]piperazin-1-yl]butyl]-1H-indole-5-carbonitrile.
| Compound Name | 3-[4-[4-[4-methyl-3-[2-(methylamino)ethyl]phenyl]piperazin-1-yl]butyl]-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 141055672 |
| Molecular Formula | C27H35N5 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.29 |
| IUPAC Name | 3-[4-[4-[4-methyl-3-[2-(methylamino)ethyl]phenyl]piperazin-1-yl]butyl]-1H-indole-5-carbonitrile |
| SMILES | CNCCc1cc(N2CCN(CCCCc3c[nH]c4ccc(C#N)cc34)CC2)ccc1C |
| InChI | InChI=1S/C27H35N5/c1-21-6-8-25(18-23(21)10-11-29-2)32-15-13-31(14-16-32)12-4-3-5-24-20-30-27-9-7-22(19-28)17-26(24)27/h6-9,17-18,20,29-30H,3-5,10-16H2,1-2H3 |
| InChIKey | VNUGMEXXTKWFDT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 58.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|