C29H29F2N5O — CID 118190898
3-[5-[4-[4-(3,5-difluoro-2-oxo-1-pyridinyl)phenyl]piperazin-1-yl]pentyl]-1H-indole-5-carbonitrile (PubChem CID 118190898) has the molecular formula C29H29F2N5O and a molecular weight of 501.58 g/mol. Its IUPAC name is 3-[5-[4-[4-(3,5-difluoro-2-oxo-1-pyridinyl)phenyl]piperazin-1-yl]pentyl]-1H-indole-5-carbonitrile.
| Compound Name | 3-[5-[4-[4-(3,5-difluoro-2-oxo-1-pyridinyl)phenyl]piperazin-1-yl]pentyl]-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 118190898 |
| Molecular Formula | C29H29F2N5O |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | 3-[5-[4-[4-(3,5-difluoro-2-oxo-1-pyridinyl)phenyl]piperazin-1-yl]pentyl]-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]cc(CCCCCN3CCN(c4ccc(-n5cc(F)cc(F)c5=O)cc4)CC3)c2c1 |
| InChI | InChI=1S/C29H29F2N5O/c30-23-17-27(31)29(37)36(20-23)25-8-6-24(7-9-25)35-14-12-34(13-15-35)11-3-1-2-4-22-19-33-28-10-5-21(18-32)16-26(22)28/h5-10,16-17,19-20,33H,1-4,11-15H2 |
| InChIKey | AABXZZAFWRPYLP-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|