C28H28ClN5O — CID 118499187
3-[4-[4-[4-[(3-chloro-2-pyridinyl)oxy]phenyl]piperazin-1-yl]butyl]-1H-indole-5-carbonitrile (PubChem CID 118499187) has the molecular formula C28H28ClN5O and a molecular weight of 486.02 g/mol. Its IUPAC name is 3-[4-[4-[4-[(3-chloro-2-pyridinyl)oxy]phenyl]piperazin-1-yl]butyl]-1H-indole-5-carbonitrile.
| Compound Name | 3-[4-[4-[4-[(3-chloro-2-pyridinyl)oxy]phenyl]piperazin-1-yl]butyl]-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 118499187 |
| Molecular Formula | C28H28ClN5O |
| Molecular Weight | 486.02 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 3-[4-[4-[4-[(3-chloro-2-pyridinyl)oxy]phenyl]piperazin-1-yl]butyl]-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]cc(CCCCN3CCN(c4ccc(Oc5ncccc5Cl)cc4)CC3)c2c1 |
| InChI | InChI=1S/C28H28ClN5O/c29-26-5-3-12-31-28(26)35-24-9-7-23(8-10-24)34-16-14-33(15-17-34)13-2-1-4-22-20-32-27-11-6-21(19-30)18-25(22)27/h3,5-12,18,20,32H,1-2,4,13-17H2 |
| InChIKey | SSWAJUDHPBEGGI-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.02 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|