C24H29ClN4O — CID 11464426
3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile;hydrochloride (PubChem CID 11464426) has the molecular formula C24H29ClN4O and a molecular weight of 424.98 g/mol. Its IUPAC name is 3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile;hydrochloride.
| Compound Name | 3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 11464426 |
| Molecular Formula | C24H29ClN4O |
| Molecular Weight | 424.98 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile;hydrochloride |
| SMILES | COc1ccccc1N1CCN(CCCCc2c[nH]c3ccc(C#N)cc23)CC1.Cl |
| InChI | InChI=1S/C24H28N4O.ClH/c1-29-24-8-3-2-7-23(24)28-14-12-27(13-15-28)11-5-4-6-20-18-26-22-10-9-19(17-25)16-21(20)22;/h2-3,7-10,16,18,26H,4-6,11-15H2,1H3;1H |
| InChIKey | KWPXQCOGCFIFDP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.98 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|